The 2-[(tert-Butyl)amino]acetyl chloride hydrochloride, with the CAS registry number 915725-52-9, is also known as N-t-butylglycine acid chloride hydrochloride. This chemical's molecular formula is C6H12ClNO.HCl and molecular weight is 186.08. What's more, its systematic name is N-(2-Chloro-2-oxoethyl)-2-methyl-2-propanaminium chloride.
Physical properties of 2-[(tert-Butyl)amino]acetyl chloride hydrochloride are: (1)#H bond acceptors: 2; (2)#H bond donors: 1; (3)#Freely Rotating Bonds: 3; (4)Polar Surface Area: 33.68 Å2.
You can still convert the following datas into molecular structure:
(1)SMILES: [Cl-].CC(C)(C)[NH2+]CC(Cl)=O
(2)Std. InChI: InChI=1S/C6H12ClNO.ClH/c1-6(2,3)8-4-5(7)9;/h8H,4H2,1-3H3;1H
(3)Std. InChIKey: DGVPZCIZHNTARH-UHFFFAOYSA-N
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View