The CAS registry number of 6H-Purin-6-one,2-amino-1,9-dihydro-9-phenyl- is 14443-33-5. This chemical is also named as Guanine,9-phenyl- (6CI,8CI). Its molecular formula is C11H9N5O and molecular weight is 227.22206. Its systematic name and IUPAC name are the same which is called 2-amino-9-phenyl-3H-purin-6-one.
Properties computed from structure about 6H-Purin-6-one,2-amino-1,9-dihydro-9-phenyl- are: (1)ACD/LogP: 1.44; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.44; (4)ACD/LogD (pH 7.4): 1.44; (5)ACD/BCF (pH 5.5): 7.28; (6)ACD/BCF (pH 7.4): 7.28; (7)ACD/KOC (pH 5.5): 144.15; (8)ACD/KOC (pH 7.4): 144.19; (9)#H bond acceptors: 6; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 1; (12)Index of Refraction: 1.804; (13)Molar Refractivity: 61.47 cm3; (14)Molar Volume: 143.1 cm3; (15)Surface Tension: 74.6 dyne/cm; (16)Density: 1.58 g/cm3; (17)Flash Point: 265.4 °C; (18)Enthalpy of Vaporization: 78.7 kJ/mol; (19)Boiling Point: 515.2 °C at 760 mmHg.
You can still convert the following datas into molecular structure:
(1)SMILES: O=C2/N=C(\Nc1n(cnc12)c3ccccc3)N
(2)InChI: InChI=1/C11H9N5O/c12-11-14-9-8(10(17)15-11)13-6-16(9)7-4-2-1-3-5-7/h1-6H,(H3,12,14,15,17)
(3)InChIKey: XOVSLVYAFGLDMS-UHFFFAOYAE
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View