The Benzenamine, 3,4-dichloro-, hydrochloride (1:1), with the CAS registry number 33240-95-8, is also known as Aniline, 3,4-dichloro-, hydrochloride (8CI). This chemical's molecular formula is C6H5Cl2 N·ClH and molecular weight is 198.48. What's more, its IUPAC name is 3,4-dichloroaniline hydrochloride.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC(=C(C=C1N)Cl)Cl.Cl
(2)InChI: InChI=1S/C6H5Cl2N.ClH/c7-5-2-1-4(9)3-6(5)8;/h1-3H,9H2;1H
(3)InChIKey: XANZVOMCLKMKMV-UHFFFAOYSA-N
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View