With the CAS registry number 96331-35-0, the IUPAC name of this chemical is N,N'-bis(2-nitrophenyl)propanediamide. When use it, people should be careful.
The other characteristics of N,N-bis(2-nitrophenyl)propanediamide can be summarized as: (1)ACD/LogP: 1.92; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 1.92; (4)ACD/LogD (pH 7.4): 1.67; (5)ACD/BCF (pH 5.5): 16.88; (6)ACD/BCF (pH 7.4): 9.55; (7)ACD/KOC (pH 5.5): 262.38; (8)ACD/KOC (pH 7.4): 148.45; (9)#H bond acceptors: 10; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 6; (12)Index of Refraction: 1.71; (13)Molar Refractivity: 87.45 cm3; (14)Molar Volume: 223.6 cm3; (15)Polarizability: 34.67×10-24 cm3; (16)Surface Tension: 76.2 dyne/cm; (17)Enthalpy of Vaporization: 99.85 kJ/mol; (18)Vapour Pressure: 2.26E-18 mmHg at 25°C; (19)Rotatable Bond Count: 4; (20)Tautomer Count: 3; (21)Exact Mass: 344.075684; (22)MonoIsotopic Mass: 344.075684; (23)Topological Polar Surface Area: 150; (24)Heavy Atom Count: 25; (25)Complexity: 483.
People can use the following data to convert to the molecule structure.
1. SMILES:O=C(Nc1ccccc1[N+]([O-])=O)CC(=O)Nc2ccccc2[N+]([O-])=O
2. InChI:InChI=1/C15H12N4O6/c20-14(16-10-5-1-3-7-12(10)18(22)23)9-15(21)17-11-6-2-4-8-13(11)19(24)25/h1-8H,9H2,(H,16,20)(H,17,21)
3. InChIKey:AESMHZVRTXLXHT-UHFFFAOYAT
4. Std. InChI:InChI=1S/C15H12N4O6/c20-14(16-10-5-1-3-7-12(10)18(22)23)9-15(21)17-11-6-2-4-8-13(11)19(24)25/h1-8H,9H2,(H,16,20)(H,17,21)
5. Std. InChIKey:AESMHZVRTXLXHT-UHFFFAOYSA-N
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View