The Benzoicacid, 2,3,4-trifluoro-, sodium salt (1:1) has the CAS registry number 402955-41-3. This chemical's molecular formula is C7H2F3NaO2 and molecular weight is 198.07. What's more, its systematic name is Sodium 2,3,4-trifluorobenzoate.
Physical properties of Benzoicacid, 2,3,4-trifluoro-, sodium salt (1:1) are: (1)#H bond acceptors: 2; (2)#H bond donors: 1; (3)#Freely Rotating Bonds: 1; (4)Polar Surface Area: 40.13 Å2.
You can still convert the following datas into molecular structure:
(1)SMILES: c1cc(c(c(c1C(=O)[O-])F)F)F.[Na+]
(2)InChI: InChI=1/C7H3F3O2.Na/c8-4-2-1-3(7(11)12)5(9)6(4)10;/h1-2H,(H,11,12);/q;+1/p-1
(3)InChIKey: NZIOVCZZRCWAHP-UHFFFAOYSA-M
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View