CasNo.7356-67-4,Arsonous diiodide,[4-(4-phenoxybenzoyl)phenyl]- (9CI),(7356-67-4) Suppliers

0 Metric Ton	Negotiable

Min.Order :0 Metric Ton
Purity: 99

Keywords

NSC 41389 [4-(4-phenoxybenzoyl)phenyl]arsonous diiodide NSC 41389

Quick Details

Appearance:
Application:The Arsonous diiodide,[4-(4-phenoxybenzoyl)phenyl]- (9CI) has the CAS registry number 7356-67-4. This chemical's molecular formula is C19H13AsI2O2 and molecular weight is 602.04. What's more, its sys
PackAge:
ProductionCapacity:|Metric Ton|Day
Storage:
Transportation:

Superiority:

The Arsonous diiodide,[4-(4-phenoxybenzoyl)phenyl]- (9CI) has the CAS registry number 7356-67-4. This chemical's molecular formula is C₁₉H₁₃AsI₂O₂ and molecular weight is 602.04. What's more, its systematic name is [4-(4-phenoxybenzoyl)phenyl]arsonous diiodide.

Physical properties of Arsonous diiodide,[4-(4-phenoxybenzoyl)phenyl]- (9CI) are: (1)#H bond acceptors: 2; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 5; (4)Polar Surface Area: 26.3 Å²; (5)Flash Point: 290.2 °C; (6)Enthalpy of Vaporization: 83.77 kJ/mol; (7)Boiling Point: 556.2 °C at 760 mmHg; (8)Vapour Pressure: 2.07E-12 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: I[As](I)c1ccc(cc1)C(=O)c3ccc(Oc2ccccc2)cc3
(2)InChI: InChI=1/C19H13AsI2O2/c21-20(22)16-10-6-14(7-11-16)19(23)15-8-12-18(13-9-15)24-17-4-2-1-3-5-17/h1-13H
(3)InChIKey: CFLBLPWSNKOODH-UHFFFAOYAP

Details:

The Arsonous diiodide,[4-(4-phenoxybenzoyl)phenyl]- (9CI) has the CAS registry number 7356-67-4. This chemical's molecular formula is C₁₉H₁₃AsI₂O₂ and molecular weight is 602.04. What's more, its systematic name is [4-(4-phenoxybenzoyl)phenyl]arsonous diiodide.

Physical properties of Arsonous diiodide,[4-(4-phenoxybenzoyl)phenyl]- (9CI) are: (1)#H bond acceptors: 2; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 5; (4)Polar Surface Area: 26.3 Å²; (5)Flash Point: 290.2 °C; (6)Enthalpy of Vaporization: 83.77 kJ/mol; (7)Boiling Point: 556.2 °C at 760 mmHg; (8)Vapour Pressure: 2.07E-12 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: I[As](I)c1ccc(cc1)C(=O)c3ccc(Oc2ccccc2)cc3
(2)InChI: InChI=1/C19H13AsI2O2/c21-20(22)16-10-6-14(7-11-16)19(23)15-8-12-18(13-9-15)24-17-4-2-1-3-5-17/h1-13H
(3)InChIKey: CFLBLPWSNKOODH-UHFFFAOYAP