Acetamide,N-[3-[3-(dimethylamino)-1-oxo-2-propen-1-yl]phenyl]-

Superiority:

The Acetamide,N-[3-[3-(dimethylamino)-1-oxo-2-propen-1-yl]phenyl]- is an organic compound with the formula C₁₃H₁₆N₂O₂. The systematic name of this chemical is N-[3-[3-(dimethylamino)prop-2-enoyl]phenyl]acetamide. With the CAS registry number 96605-61-7, it is also named as N-[3-(3-Dimethylamino-1-oxo-2-propenyl)phenyl]acetamide. 

The other characteristics of Acetamide,N-[3-[3-(dimethylamino)-1-oxo-2-propen-1-yl]phenyl]- can be summarized as: (1)ACD/LogP: 1.52; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.57; (4)ACD/LogD (pH 7.4): 1.47; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 7.56; (7)ACD/KOC (pH 5.5): 17.88; (8)ACD/KOC (pH 7.4): 143.77; (9)#H bond acceptors: 4; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 49.41 Å²; (13)Index of Refraction: 1.582; (14)Molar Refractivity: 68.23 cm³; (15)Molar Volume: 204.4 cm³; (16)Polarizability: 27.04×10^-24 cm³; (17)Surface Tension: 44.6 dyne/cm; (18)Density: 1.136 g/cm³; (19)Flash Point: 211.1 °C; (20)Enthalpy of Vaporization: 68 kJ/mol; (21)Boiling Point: 425.4 °C at 760 mmHg; (22)Vapour Pressure: 1.92E-07 mmHg at 25°C.

People can use the following data to convert to the molecule structure. 
1. SMILES:CC(=O)Nc1cccc(c1)C(=O)C=CN(C)C
2. InChI:InChI=1/C13H16N2O2/c1-10(16)14-12-6-4-5-11(9-12)13(17)7-8-15(2)3/h4-9H,1-3H3,(H,14,16)
3. InChIKey:AIWCFDGABJPHDI-UHFFFAOYAU 
4. Std. InChI:InChI=1S/C13H16N2O2/c1-10(16)14-12-6-4-5-11(9-12)13(17)7-8-15(2)3/h4-9H,1-3H3,(H,14,16) 
5. Std. InChIKey:AIWCFDGABJPHDI-UHFFFAOYSA-N