The Benzene,1,3,5-tris(azidomethyl)-2,4,6-triethyl-, with the CAS registry number 190779-62-5, has the molecular formula C15H21N9. Besides, its molecular weight is 327.3875. Its systematic name is called 1,3,5-tris(azidomethyl)-2,4,6-triethylbenzene.
Physical properties of Benzene,1,3,5-tris(azidomethyl)-2,4,6-triethyl-: (1)ACD/LogP: 4.41; (2)ACD/LogD (pH 5.5): 6; (3)ACD/LogD (pH 7.4): 6; (4)ACD/BCF (pH 5.5): 10542; (5)ACD/BCF (pH 7.4): 10542; (6)ACD/KOC (pH 5.5): 26375; (7)ACD/KOC (pH 7.4): 26375; (8)#H bond acceptors: 9; (9)#H bond donors: 0; (10)#Freely Rotating Bonds: 9; (11)Polar Surface Area: 37.08 Å2.
You can still convert the following datas into molecular structure:
(1)SMILES: [N-]=[N+]=N\Cc1c(c(c(c(c1CC)C\N=[N+]=[N-])CC)C\N=[N+]=[N-])CC
(2)InChI: InChI=1/C15H21N9/c1-4-10-13(7-19-22-16)11(5-2)15(9-21-24-18)12(6-3)14(10)8-20-23-17/h4-9H2,1-3H3
(3)InChIKey: LOTFAMQIFWUARY-UHFFFAOYAS
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View