104857-48-9 Usage
Description
4-(2-Oxiranylmethoxy)-benzeneethanol, with the CAS number 104857-48-9, is a white solid compound that is primarily utilized in the field of organic synthesis. It is known for its unique chemical properties that make it a valuable component in various chemical reactions and processes.
Uses
Used in Organic Synthesis:
4-(2-Oxiranylmethoxy)-benzeneethanol is used as a key intermediate for the synthesis of various organic compounds. Its application is due to its unique chemical structure, which allows it to participate in a wide range of reactions, including nucleophilic substitution, ring-opening reactions, and other transformations.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-(2-Oxiranylmethoxy)-benzeneethanol is used as a building block for the development of new drugs. Its ability to undergo various chemical reactions makes it a versatile component in the synthesis of complex molecules with potential therapeutic applications.
Used in Flavor and Fragrance Industry:
4-(2-Oxiranylmethoxy)-benzeneethanol is also utilized in the flavor and fragrance industry as a component in the creation of unique scents and flavors. Its chemical properties allow it to contribute to the overall profile of a fragrance or flavor, enhancing the sensory experience.
Used in Material Science:
In the field of material science, 4-(2-Oxiranylmethoxy)-benzeneethanol is employed in the development of novel materials with specific properties. Its chemical structure can be manipulated to create materials with tailored characteristics, such as improved mechanical strength, thermal stability, or chemical resistance.
Overall, 4-(2-Oxiranylmethoxy)-benzeneethanol is a versatile compound with a wide range of applications across various industries, including organic synthesis, pharmaceuticals, flavor and fragrance, and material science. Its unique chemical properties and ability to participate in various reactions make it a valuable asset in the development of new products and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 104857-48-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,4,8,5 and 7 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 104857-48:
(8*1)+(7*0)+(6*4)+(5*8)+(4*5)+(3*7)+(2*4)+(1*8)=129
129 % 10 = 9
So 104857-48-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H14O3/c12-6-5-9-1-3-10(4-2-9)13-7-11-8-14-11/h1-4,11-12H,5-8H2
104857-48-9Relevant articles and documents
EPOXY-(METH)ACRYLATE MONOMERS AND POLYMERS AND METHODS OF MAKING AND USING THE SAME
-
Paragraph 0172-0174, (2020/02/27)
The present invention relates to the unexpected discovery of novel monomer compounds capable of crosslinking interpenetrating polymer networks (IPNs). In certain embodiments, the monomer compounds of the invention each comprise at least one methacrylate f
Chemoenzymatic route to S-betaxolol
Li, Yong-Hong,Huang, Li-Hua,Liu, Hong-Min
scheme or table, p. 2468 - 2474 (2011/08/05)
An efficient chemoenzymatic route to S-betaxolol is reported. A strain (Rhodotorula mucilaginosa DQ832198) screened from soil was used as biocatalyst for the kinetic resolution of the key acetylated intermediates. Excellent enantiomeric excess (ee99%) was
Concise synthesis of β-blockers (S)-metoprolol and (S)-betaxolol using hydrolytic kinetic resolution
Muthukrishnan,Garud, Dinesh R.,Joshi,Joshi
, p. 1872 - 1876 (2007/10/03)
Enantiopure (S)-metoprolol and (S)-betaxolol were prepared in an extremely simple and practical way using Jacobsen's hydrolytic kinetic resolution of terminal epoxides in isopropanol.