52344-93-1 Usage
Description
METHYL 2-FORMYL-3,5-DIMETHOXYBENZOATE is an organic compound with the molecular formula C11H10O5. It is characterized by its benzoate structure, featuring a formyl group at the 2-position, and two methoxy groups at the 3 and 5 positions. METHYL 2-FORMYL-3,5-DIMETHOXYBENZOATE is known for its potential applications in various fields, particularly in the synthesis of other organic compounds.
Uses
Used in Chemical Synthesis:
METHYL 2-FORMYL-3,5-DIMETHOXYBENZOATE is used as a key intermediate in the synthesis of various organic compounds, particularly in the preparation of complex molecules with potential applications in different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, METHYL 2-FORMYL-3,5-DIMETHOXYBENZOATE is used as a starting material for the synthesis of novel drug candidates. Its unique structure allows for the development of new molecules with potential therapeutic properties.
Used in the Preparation of Methyl (E)-3,5-Dimethoxy-2-[2-(4-Methoxybenzoyl)hydrazin-1-ylidene]methyl-Benzoate:
METHYL 2-FORMYL-3,5-DIMETHOXYBENZOATE is specifically used in the preparation of methyl (E)-3,5-dimethoxy-2-[2-(4-methoxybenzoyl)hydrazin-1-ylidene]methyl-benzoate, a compound with potential applications in various fields, such as pharmaceuticals or materials science. The synthesis of this compound involves the reaction of METHYL 2-FORMYL-3,5-DIMETHOXYBENZOATE with other reagents, leading to the formation of the desired product.
Check Digit Verification of cas no
The CAS Registry Mumber 52344-93-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,3,4 and 4 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 52344-93:
(7*5)+(6*2)+(5*3)+(4*4)+(3*4)+(2*9)+(1*3)=111
111 % 10 = 1
So 52344-93-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H12O5/c1-14-7-4-8(11(13)16-3)9(6-12)10(5-7)15-2/h4-6H,1-3H3
52344-93-1Relevant articles and documents
Convergent total synthesis of corallocin A
Mashiko, Tomoya,Nakazato, Yuta,Katsumura, Yuta,Kasamatsu, Akihiko,Adachi, Shinya,Kamo, Shogo,Matsuzawa, Akinobu,Sugita, Kazuyuki
supporting information, p. 5127 - 5132 (2021/06/21)
The first total synthesis of corallocin A is described herein. The Suzuki coupling reaction as a key step proceeded with high stereoselectivity and in good yield. Robust transformations, including Vilsmeier-Haack formylation and Wittig reaction, allowed for effective access to corallocin A.
CHEMICAL METHOD OF PRODUCING SMTP GROUPS OR SMTP-7 AND INTERMEDIATES USED IN THE METHOD
-
Paragraph 0024-0026, (2020/05/29)
The present invention provides a compound having a dihydropyran structure, a method of producing a compound having a dihydropyran structure, a method of producing Pre-SMTP, a method of producing a group of SMTPs, and a pharmaceutical composition. The comp
Aminopyrimidine compound
-
Paragraph 0091; 0094; 0096; 0097; 0098, (2019/08/12)
The invention discloses an aminopyrimidine compound. The structural general formula of the compounds is shown as a formula I in the specification. In the formula I, R1 is one of alkyl with a carbon atom total number of 1-6, cycloalkyl with a carbon atom total number of 3-6, halogen substituted alkyl with a carbon atom total number of 1-6 and halogen substituted cycloalkyl with a carbon atom totalnumber of 3-6, R2 is alkoxy with a carbon atom total number of 1-6, halogen substituted alkoxy with a carbon atom total number of 1-6, cycloalkyl with a carbon atom total number of 3-6 and halogen substituted cycloalkyl with a carbon atom total number of 3-6, and X is F, Br or Cl. The compound has a remarkable antibacterial effect and a good drug forming property.
