776-53-4 Usage
Description
4-AMINO-2-METHYLSULFANYL-PYRIMIDINE-5-CARBOXYLIC ACID ETHYL ESTER, also known as Ethyl 4-amino-2-(methylthio)pyrimidine-5-carboxylate, is a white solid compound with significant potential in the pharmaceutical industry. It is characterized by its unique chemical structure, which allows it to be used in the development of various therapeutic agents.
Uses
Used in Pharmaceutical Industry:
4-AMINO-2-METHYLSULFANYL-PYRIMIDINE-5-CARBOXYLIC ACID ETHYL ESTER is used as a key intermediate compound for the preparation of pyrimidopyrimidines. These pyrimidopyrimidines are known to act as protein kinase inhibitors, which play a crucial role in the regulation of various cellular processes, including cell signaling, growth, and differentiation. By inhibiting these protein kinases, pyrimidopyrimidines can potentially be used in the treatment of various diseases, such as cancer and other proliferative disorders.
Used in Cancer Treatment:
4-AMINO-2-METHYLSULFANYL-PYRIMIDINE-5-CARBOXYLIC ACID ETHYL ESTER is used as a precursor in the synthesis of pyrimidopyrimidines, which have demonstrated potential as anticancer agents. These compounds can modulate various oncological signaling pathways, leading to the inhibition of tumor growth and progression. Additionally, pyrimidopyrimidines may exhibit synergistic effects when combined with conventional chemotherapeutic drugs, enhancing their efficacy and overcoming drug resistance in cancer treatment.
Used in Drug Delivery Systems:
To improve the bioavailability and therapeutic outcomes of pyrimidopyrimidines, novel drug delivery systems are being developed. These systems utilize various organic and metallic nanoparticles as carriers for the delivery of pyrimidopyrimidines, aiming to enhance their solubility, stability, and targeted delivery to cancer cells. This approach can potentially improve the overall effectiveness of these compounds in cancer treatment and reduce side effects associated with conventional chemotherapy.
Check Digit Verification of cas no
The CAS Registry Mumber 776-53-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,7 and 6 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 776-53:
(5*7)+(4*7)+(3*6)+(2*5)+(1*3)=94
94 % 10 = 4
So 776-53-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H11N3O2S/c1-3-13-7(12)5-4-10-8(14-2)11-6(5)9/h4H,3H2,1-2H3,(H2,9,10,11)
