The (R)-1-(3-Fluorophenyl)ethylamine hydrochloride, with the CAS registry number 321429-49-6, is also known as Benzenemethanamine, 3-fluoro-α-methyl-, (alphaR)-, hydrochloride (1:1). It belongs to the product category of API intermediates. This chemical's molecular formula is C8H10FN.HCl and molecular weight is 175.63. Its IUPAC name and systematic name are the same which is called (1R)-1-(3-fluorophenyl)ethanamine hydrochloride.
You can still convert the following datas into molecular structure of (R)-1-(3-Fluorophenyl)ethylamine hydrochloride:
(1)SMILES: CC(c1cccc(c1)F)N.Cl
(2)InChI: InChI=1/C8H10FN.ClH/c1-6(10)7-3-2-4-8(9)5-7;/h2-6H,10H2,1H3;1H/t6-;/m1./s1
(3)InChIKey: RKALWMOKWLLQMU-FYZOBXCZBP
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View