The CAS registry number of 1-Azido-3-chloro-2-propanol is 51275-91-3. This chemical is also named as 3-Chloro-1-azidoisopropanol. In addition, its molecular formula is C3H6ClN3O and molecular weight is 135.5522. Its systematic name is called 1-Azido-3-chloropropan-2-ol.
Physical properties about 1-Azido-3-chloro-2-propanol are: (1)ACD/LogP: 0.39; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0; (4)ACD/LogD (pH 7.4): 0; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 33; (8)ACD/KOC (pH 7.4): 33; (9)#H bond acceptors: 4; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 4.
You can still convert the following datas into molecular structure:
(1)SMILES: [N-]=[N+]=N\CC(O)CCl
(2)InChI: InChI=1/C3H6ClN3O/c4-1-3(8)2-6-7-5/h3,8H,1-2H2
(3)InChIKey: DTXBDTUEXOVFTN-UHFFFAOYAO
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View