The 1-Benzyl-4-chloropiperidinium chloride, with the CAS registry number 21937-57-5, is also known as 1-Benzyl-4-chloro-piperidin-1-ium chloride. Its EINECS registry number is 244-668-3. This chemical's molecular formula is C12H17Cl2N and molecular weight is 246.17608. What's more, its IUPAC name is called 1-Benzyl-4-chloropiperidine hydrochloride.
Physical properties about 1-Benzyl-4-chloropiperidinium chloride are: (1)#H bond acceptors: 1; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 2.
You can still convert the following datas into molecular structure:
(1) SMILES: [Cl-].ClC2CC[NH+](Cc1ccccc1)CC2
(2) InChI: InChI=1/C12H16ClN.ClH/c13-12-6-8-14(9-7-12)10-11-4-2-1-3-5-11;/h1-5,12H,6-10H2;1H
(3) InChIKey: OHKKMIMUBHLTNF-UHFFFAOYAO
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View