The Benzenediazonium,2-chloro-, with the CAS registry number 17333-83-4, is also known as o-Chlorobenzenediazonium. Its EINECS number is 241-355-3. This chemical's molecular formula is C6H4ClN2 and molecular weight is 139.56. What's more, its systematic name is 2-chlorobenzenediazonium.
Physical properties of Benzenediazonium,2-chloro- are: (1)#H bond acceptors: 2; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 1; (4)Polar Surface Area: 28.15 Å2.
You can still convert the following datas into molecular structure:
(1)SMILES: N#[N+]c1ccccc1Cl
(2)Std. InChI: InChI=1S/C6H4ClN2/c7-5-3-1-2-4-6(5)9-8/h1-4H/q+1
(3)Std. InChIKey:HGOUHLGJFUPVGS-UHFFFAOYSA-N
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View