The 1H-Indole,4,6-dichloro-2,3-dihydro-, with the CAS registry number 903551-23-5, is also known as 4,6-Dichloroindoline hydrochloride. This chemical's molecular formula is C8H8Cl3N and molecular weight is 224.51482. Its IUPAC name is called 4,6-dichloro-2,3-dihydro-1H-indole hydrochloride.
Physical properties of 1H-Indole,4,6-dichloro-2,3-dihydro-: (1)H-Bond Donor: 2; (2)H-Bond Acceptor: 1; (3)Rotatable Bond Count: 0; (4)Exact Mass: 222.972232; (5)MonoIsotopic Mass: 222.972232; (6)Topological Polar Surface Area: 12; (7)Heavy Atom Count: 12; (8)Formal Charge: 0; (9)Complexity: 151; (10)Covalently-Bonded Unit Count: 2.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1CNC2=CC(=CC(=C21)Cl)Cl.Cl
(2)InChI: InChI=1S/C8H7Cl2N.ClH/c9-5-3-7(10)6-1-2-11-8(6)4-5;/h3-4,11H,1-2H2;1H
(3)InChIKey: RREOOKIQVLLQMO-UHFFFAOYSA-N
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View