The 6-Quinoxalinol, 1,4-dioxide has the CAS registry number 7467-92-7. This chemical's molecular formula is C8H6N2O3 and molecular weight is 178.14. What's more, its systematic name is 6-hydroxy-1,4-dioxo-1,4-dihydroquinoxalinediium.
Physical properties of 6-Quinoxalinol, 1,4-dioxide are: (1)#H bond acceptors: 5; (2)#H bond donors: 1; (3)#Freely Rotating Bonds: 1; (4)Polar Surface Area: 49.39 Å2.
You can still convert the following datas into molecular structure:
(1)SMILES: O=[N+]/2c1cc(O)ccc1[N+](=O)\C=C\2
(2)InChI: InChI=1S/C8H5N2O3/c11-6-1-2-7-8(5-6)10(13)4-3-9(7)12/h1-5H/q+1/p+1
(3)InChIKey: HVPWYPDNHDPPOP-UHFFFAOYSA-O
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View