The Phenanthridinium, 5-methyl-, chloride (1:1), with the CAS registry number 65201-98-1, is also known as N-Methylphenanthridinium chloride. This chemical's molecular formula is C14H12ClN and molecular weight is 229.7. What's more, its systematic name is 5-methylphenanthridinium chloride.
Computational chemistry data of Phenanthridinium, 5-methyl-, chloride (1:1) are: (1)H-Bond Donor 0; (2)H-Bond Acceptor 1; (3)Rotatable Bond Count 0; (4)Exact Mass 229.065827; (5)MonoIsotopic Mass 229.065827; (6)Topological Polar Surface Area 3.9; (7)Heavy Atom Count 16; (8)Formal Charge 0; (9)Complexity 225; (10)Isotope Atom Count 0; (11)Defined Atom StereoCenter Count 0; (12)Undefined Atom StereoCenter Count 0; (13)Defined Bond StereoCenter Count 0; (14)Undefined Bond StereoCenter Count 0; (15)Covalently-Bonded Unit Count 2.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C[N+]1=CC2=CC=CC=C2C3=CC=CC=C31.[Cl-]
(2)InChI: InChI=1S/C14H12N.ClH/c1-15-10-11-6-2-3-7-12(11)13-8-4-5-9-14(13)15;/h2-10H,1H3;1H/q+1;/p-1
(3)InChIKey: CDIPADBUKXVJFU-UHFFFAOYSA-M
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View