The Ethanaminium,N,N,N-trimethyl-2-(phosphonooxy)-, chloride (1:1) with CAS registry number of 107-73-3 is also known as Phosphorylcholine. The IUPAC name is Trimethyl(2-(phosphonooxy)ethyl)ammonium chloride. Its EINECS registry number is 203-516-6. In addition, the formula is C5H15NO4P.Cl and the molecular weight is 219.60.
Physical properties about Ethanaminium,N,N,N-trimethyl-2-(phosphonooxy)-, chloride (1:1) are: (1)ACD/LogP: -4.99; (2)ACD/LogD (pH 5.5): -4.49; (3)ACD/LogD (pH 7.4): -5.25; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 5; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 4; (11)Polar Surface Area: 54.57Å2.
You can still convert the following datas into molecular structure:
1. Canonical SMILES: C[N+](C)(C)CCOP(=O)(O)O.[Cl-]
2. InChI: InChI=1S/C5H14NO4P.ClH/c1-6(2,3)4-5-10-11(7,8)9;/h4-5H2,1-3H3,(H-,7,8,9);1H
3. InChIKey: PYJNAPOPMIJKJZ-UHFFFAOYSA-N
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View