9,9-Dimethyl-9H-fluoren-2-yl-boronic acid

Details:

1. Introduction of 9,9-Dimethyl-9H-fluoren-2-yl-boronic acid
The 9,9-Dimethyl-9H-fluoren-2-yl-boronic acid, with the CAS registry number 333432-28-3, is also known as Boronic acid, B-(9,9-dimethyl-9H-fluoren-2-yl)-. The IUPAC name of it is (9,9-dimethylfluoren-2-yl)boronic acidIt belongs to the product categories of Boron Compounds; Electronic Chemicals. Its molecular formula is C₁₅H₁₅BO₂ and molecular weight is 238.09.

2. Properties of 9,9-Dimethyl-9H-fluoren-2-yl-boronic acid
9,9-Dimethyl-9H-fluoren-2-yl-boronic acid is white powder
(1)ACD/LogP: 4.30; (2)ACD/LogD (pH 5.5): 5; (3)ACD/LogD (pH 7.4): 5; (4)ACD/BCF (pH 5.5): 1742; (5)ACD/BCF (pH 7.4): 1644; (6)ACD/KOC (pH 5.5): 7268; (7)ACD/KOC (pH 7.4): 6861; (8)#H bond acceptors: 2; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 3; (11)Index of Refraction: 1.628; (12)Molar Refractivity: 69.838 cm³; (13)Molar Volume: 196.864 cm³; (14)Surface Tension: 51.424 dyne/cm; (15)Density: 1.209 g/cm³; (16)Flash Point: 217.759 °C; (17)Enthalpy of Vaporization: 73.034 kJ/mol; (18)Boiling Point: 436.453 °C at 760 mmHg; (19)Vapour Pressure: 0 mmHg at 25°C.

3. Structure Descriptors of 9,9-Dimethyl-9H-fluoren-2-yl-boronic acid
(1)Canonical SMILES: B(C1=CC2=C(C=C1)C3=CC=CC=C3C2(C)C)(O)O
(2)InChI: InChI=1S/C15H15BO2/c1-15(2)13-6-4-3-5-11(13)12-8-7-10(16(17)18)9-14(12)15/h3-9,17-18H,1-2H3
(3)InChIKey: DMDPAJOXRYGXCB-UHFFFAOYSA-N

4. Use of 9,9-Dimethyl-9H-fluoren-2-yl-boronic acid
9,9-Dimethyl-9H-fluoren-2-yl-boronic acid is widely used in intermediate; oled material; organic chemicals; pharmaceutical; intermediates; phosphorescent dopant materials; functional materials.