25148-68-9 Usage
Description
N-Methyl-1,2-benzenediamine dihydrochloride, also known as N-Methyl-o-phenylenediamine dihydrochloride, is an organic compound with the CAS number 25148-68-9. It is characterized by its light purple crystalline structure, typically obtained from ethanol. N-Methyl-1,2-benzenediamine dihydrochloride is widely recognized for its utility in various organic synthesis processes, making it a valuable component in the field of chemistry.
Uses
Used in Organic Synthesis:
N-Methyl-1,2-benzenediamine dihydrochloride is used as a synthetic building block for the creation of various organic compounds. Its unique chemical structure allows it to participate in a range of reactions, facilitating the formation of complex molecules with diverse applications across different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, N-Methyl-1,2-benzenediamine dihydrochloride is utilized as an intermediate in the synthesis of various drugs and pharmaceutical compounds. Its ability to form a variety of chemical bonds makes it a versatile component in the development of new medications, potentially contributing to the treatment of various medical conditions.
Used in Chemical Research:
N-Methyl-1,2-benzenediamine dihydrochloride is also employed as a research tool in the field of chemistry. Its unique properties and reactivity make it an ideal candidate for studying various chemical reactions and mechanisms, furthering our understanding of organic chemistry and potentially leading to the discovery of new compounds and applications.
Used in Dye and Pigment Industry:
The light purple color of N-Methyl-1,2-benzenediamine dihydrochloride crystals makes it a potential candidate for use in the dye and pigment industry. Its ability to produce vibrant colors can be harnessed in the creation of dyes and pigments for various applications, such as textiles, plastics, and printing inks.
Air & Water Reactions
Water soluble.
Reactivity Profile
N-Methyl-1,2-benzenediamine dihydrochloride is an acidic salt. Materials in this group are generally soluble in water. The resulting solutions contain moderate concentrations of hydrogen ions and have pH's of less than 7.0. They react as acids to neutralize bases. These neutralizations generate heat, but less or far less than is generated by neutralization of inorganic acids, inorganic oxoacids, and carboxylic acid. They usually do not react as either oxidizing agents or reducing agents but such behavior is not impossible. Many of these compounds catalyze organic reactions.
Fire Hazard
Flash point data for N-Methyl-1,2-benzenediamine dihydrochloride are not available; however, N-Methyl-1,2-benzenediamine dihydrochloride is probably combustible.
Check Digit Verification of cas no
The CAS Registry Mumber 25148-68-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,1,4 and 8 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 25148-68:
(7*2)+(6*5)+(5*1)+(4*4)+(3*8)+(2*6)+(1*8)=109
109 % 10 = 9
So 25148-68-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2.2ClH/c1-9-7-5-3-2-4-6(7)8;;/h2-5,9H,8H2,1H3;2*1H