1,7-Dimethyl-1H-pyrido[2,3-d][1,3]oxazine-2,4-dione

The chemical with CAS registry number of  is known as 1,7-Dimethyl-1H-pyrido[2,3-d][1,3]oxazine-2,4-dione. The IUPAC name is 1,7-Dimethylpyrido[2,3-d][1,3]oxazine-2,4-dione. In addition, the formula is C₉H₈N₂O₃ and the molecular weight is 192.17.

Physical properties about 1,7-Dimethyl-1H-pyrido[2,3-d][1,3]oxazine-2,4-dione are: (1)ACD/LogP: 0.80; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 15; (5)ACD/KOC (pH 7.4): 15; (6)#H bond acceptors: 5; (7)Index of Refraction: 1.58; (8)Molar Refractivity: 46.872 cm³; (9)Molar Volume: 140.854 cm³; (10)Surface Tension: 54.863 dyne/cm; (11)Density: 1.364 g/cm³; (12)Flash Point: 165.015 °C; (13)Enthalpy of Vaporization: 59.371 kJ/mol; (14)Boiling Point: 349.241 °C at 760 mmHg.

Preparation of 1,7-Dimethyl-1H-pyrido[2,3-d][1,3]oxazine-2,4-dione: it is prepared by reaction of carbonyl dichloride with 2-methylamino-6-methylnicotinic acid sodium salt. The reaction needs solvents H₂O, benzene for 2 hours. The yield is about 51%.

Uses of 1,7-Dimethyl-1H-pyrido[2,3-d][1,3]oxazine-2,4-dione: it is used to produce 1-[(6-methyl-2-methylamino)-3-pyridinyl]-2-nitroethanone by reaction with nitromethane. The reaction occurs with reagent potassium carbonate and solvent dimethylsulfoxide at ambient temperature for 5 hours. The yield is about 63%.

You can still convert the following datas into molecular structure:
1. SMILES: O=C2OC(=O)N(C)c1nc(C)ccc12
2. InChI: InChI=1/C9H8N2O3/c1-5-3-4-6-7(10-5)11(2)9(13)14-8(6)12/h3-4H,1-2H3
3. InChIKey: CLGNGRQWSNKXLY-UHFFFAOYAH
4. Std. InChI: InChI=1S/C9H8N2O3/c1-5-3-4-6-7(10-5)11(2)9(13)14-8(6)12/h3-4H,1-2H3
5. Std. InChIKey: CLGNGRQWSNKXLY-UHFFFAOYSA-N