The CAS registry number of 2,4(1H,3H)-Quinazolinedione,3-(2-hydroxyethyl)- is 1207-75-6. Its EINECS registry number is 214-897-3. This chemical's molecular formula is C10H10N2O3 and molecular weight is 206.198. Its systematic name is called 3-(2-hydroxyethyl)quinazoline-2,4(1H,3H)-dione.
Physical properties of 2,4(1H,3H)-Quinazolinedione,3-(2-hydroxyethyl)-: (1)ACD/LogP: 0.23; (2)ACD/LogD (pH 5.5): 0.23; (3)ACD/LogD (pH 7.4): 0.23; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 31.72; (7)ACD/KOC (pH 7.4): 31.72; (8)#H bond acceptors: 5; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 3; (11)Index of Refraction: 1.6; (12)Molar Refractivity: 51.85 cm3; (13)Molar Volume: 151.4 cm3; (14)Surface Tension: 56.1 dyne/cm; (15)Density: 1.361 g/cm3.
You can still convert the following datas into molecular structure:
(1)SMILES: O=C2c1c(cccc1)NC(=O)N2CCO
(2)InChI: InChI=1/C10H10N2O3/c13-6-5-12-9(14)7-3-1-2-4-8(7)11-10(12)15/h1-4,13H,5-6H2,(H,11,15)
(3)InChIKey: DSUNWRHRAQZLNC-UHFFFAOYAL
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View