The Pentanedioic acid, 2-hydroxy-, sodium salt (1:2), with the CAS registry number 63512-50-5, is also known as L-alpha-Hydroxyglutaric acid, disodium salt. This chemical's molecular formula is C5H8Na2O5 and molecular weight is 199.14. What's more, its systematic name is disodium 2-hydroxypentanedioic acid.
You can still convert the following datas into molecular structure:
(1)SMILES: C(CC(=O)O)C(C(=O)O)O.[Na+].[Na+]
(2)InChI: InChI=1S/C5H8O5.2Na/c6-3(5(9)10)1-2-4(7)8;;/h3,6H,1-2H2,(H,7,8)(H,9,10);;/q;2*+1
(3)InChIKey: DZHFTEDSQFPDPP-UHFFFAOYSA-N
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View