Country:China (Mainland)
Year Established: 2002Business type: Other
Integral:
1. what is citric acid (CAS No. 77-92-9)
Citric acid Product Name: Citric acid
Citric acid CAS Registry Number: 77-92-9
Synonyms: Citric acid anhydrous; 2-Hydroxy-1,2,3-propanetricarboxylic acid; 2-Hydroxytricarballylic acid
Citric acid Formula: C6H8O7
Molecular Weight: 192.12
EINECS: 201-069-1
2. Safety Information of Citric acid (CAS No. 77-92-9)
Citric acid Hazard Codes: Xi,C
Citric acid Risk Statements: 41-36/37/38-36/38-37/38-34
Citric acid Safety Statements: 26-39-37/39-24/25-36/37/39-45-36
RIDADR: UN 1789 8/PG 3
WGK Germany: 1
RTECS: GE735000
F: 9
Hazardous Substances Data: 77-92-9(Hazardous Substances Data)
3. Citric acid (CAS No. 77-92-9) chemical structure
The chemical structure of Citric acid (CAS No. 77-92-9) are as below:
(1). InChI: InChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)
(2). InChIKey: InChIKey=KRKNYBCHXYNGOX-UHFFFAOYSA-N
(3). Smiles: C(CC(O)=O)(CC(O)=O)(C(O)=O)O
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View